Benzyl 4-cyanopiperidine-1-carboxylate structure
|
Common Name | Benzyl 4-cyanopiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 161609-84-3 | Molecular Weight | 244.28900 | |
| Density | 1.18g/cm3 | Boiling Point | 416.5ºC at 760mmHg | |
| Molecular Formula | C14H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.7ºC | |
| Name | 1-N-Cbz-4-Cyanopiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 416.5ºC at 760mmHg |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.28900 |
| Flash Point | 205.7ºC |
| Exact Mass | 244.12100 |
| PSA | 53.33000 |
| LogP | 2.49668 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | UGKXZMBTBFELAS-UHFFFAOYSA-N |
| SMILES | N#CC1CCN(C(=O)OCc2ccccc2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
Benzyl 4-cyanop... CAS#:161609-84-3 |
| Literature: EP1308439 A1, ; |
|
~%
Benzyl 4-cyanop... CAS#:161609-84-3 |
| Literature: Advanced Synthesis and Catalysis, , vol. 349, # 8-9 p. 1475 - 1480 |
|
~%
Benzyl 4-cyanop... CAS#:161609-84-3 |
| Literature: US5654299 A1, ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzyl 4-cyanopiperidine-1-carboxylate |
| 1-N-Cbz-4-cyanopiperidine |