1-benzylpyridin-1-ium-3-carbonitrile
1-benzylpyridin-1-ium-3-carbonitrile structure
|
Common Name | 1-benzylpyridin-1-ium-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 16183-87-2 | Molecular Weight | 195.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 1-Benzylpyridin-1-ium-3-carbonitrile (Chinese name: 1-苯基吡啶-1-碳鎓-3-氰化物, CAS number: 16183-87-2, molecular formula: C13H11N2, molecular weight: 195.24), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-benzylpyridin-1-ium-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11N2 |
|---|---|
| Molecular Weight | 195.24000 |
| Exact Mass | 195.09200 |
| PSA | 27.67000 |
| LogP | 1.89408 |
| InChIKey | GLTIROWHVNKHBW-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc[n+](Cc2ccccc2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-benzylpyridin... CAS#:16183-87-2 |
| Literature: Powell, Michael F.; Bruice, Thomas C. Journal of the American Chemical Society, 1983 , vol. 105, # 105 p. 1014 - 1021 |
|
~%
1-benzylpyridin... CAS#:16183-87-2 |
| Literature: Zhu, Xiao-Qing; Deng, Fei-Huang; Yang, Jin-Dong; Li, Xiu-Tao; Chen, Qiang; Lei, Nan-Ping; Meng, Fan-Kun; Zhao, Xiao-Peng; Han, Su-Hui; Hao, Er-Jun; Mu, Yuan-Yuan Organic and Biomolecular Chemistry, 2013 , vol. 11, # 36 p. 6071 - 6089 |
|
~%
1-benzylpyridin... CAS#:16183-87-2 |
| Literature: Buckley, Neil; Maltby, David; Burlingame, Alma L.; Oppenheimer, Norman J. Journal of Organic Chemistry, 1996 , vol. 61, # 8 p. 2753 - 2762 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Benzyl-3-cyanpyridinium |
| Pyridinium,3-cyano-1-(phenylmethyl) |
| N-Benzyl-3-cyanopyridinium |
| 1-benzyl-3-cyano-pyridinium |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-benzylpyridin-1-ium-3-carbonitrile? |
| A: LogP of 1-benzylpyridin-1-ium-3-carbonitrile is 1.89408. |
| Q: What is the molecular formula of 1-benzylpyridin-1-ium-3-carbonitrile? |
| A: Molecular formula of 1-benzylpyridin-1-ium-3-carbonitrile is C13H11N2. |
| Q: What is the CAS number of 1-benzylpyridin-1-ium-3-carbonitrile? |
| A: CAS number of 1-benzylpyridin-1-ium-3-carbonitrile is 16183-87-2. |
| Q: What English synonyms does 1-benzylpyridin-1-ium-3-carbonitrile have? |
| A: English synonyms of 1-benzylpyridin-1-ium-3-carbonitrile: 1-Benzyl-3-cyanpyridinium, Pyridinium,3-cyano-1-(phenylmethyl), N-Benzyl-3-cyanopyridinium, 1-benzyl-3-cyano-pyridinium. |
| Q: What is the InChIKey of 1-benzylpyridin-1-ium-3-carbonitrile? |
| A: InChIKey of 1-benzylpyridin-1-ium-3-carbonitrile is GLTIROWHVNKHBW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-benzylpyridin-1-ium-3-carbonitrile? |
| A: SMILES notation of 1-benzylpyridin-1-ium-3-carbonitrile is N#Cc1ccc[n+](Cc2ccccc2)c1. |
| Q: What is the polar surface area (PSA) of 1-benzylpyridin-1-ium-3-carbonitrile? |
| A: Polar surface area (PSA) of 1-benzylpyridin-1-ium-3-carbonitrile is 27.67000. |
| Q: What is the English name of 1-benzylpyridin-1-ium-3-carbonitrile? |
| A: The English name of 1-benzylpyridin-1-ium-3-carbonitrile is 1-benzylpyridin-1-ium-3-carbonitrile. |
| Q: What is the Chinese name of 16183-87-2? |
| A: Chinese name of 16183-87-2 is 16183-87-2. |
| Q: What is the molecular weight of 1-benzylpyridin-1-ium-3-carbonitrile? |
| A: Molecular weight of 1-benzylpyridin-1-ium-3-carbonitrile is 195.24000. |