NSC636819 structure
|
Common Name | NSC636819 | ||
|---|---|---|---|---|
| CAS Number | 1618672-71-1 | Molecular Weight | 510.15 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 625.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H12Cl4N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 332.1±31.5 °C | |
Use of NSC636819NSC636819 is a competitive and selective inhibitor of KDM4A/KDM4B. KDM4A/KDM4B are potential progression factors for prostate cancer. NSC636819 has the potential for the research of cancer diseases, especially prostate cancer[1]. |
| Name | NSC 636819 |
|---|---|
| Synonym | More Synonyms |
| Description | NSC636819 is a competitive and selective inhibitor of KDM4A/KDM4B. KDM4A/KDM4B are potential progression factors for prostate cancer. NSC636819 has the potential for the research of cancer diseases, especially prostate cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 625.5±55.0 °C at 760 mmHg |
| Molecular Formula | C22H12Cl4N2O4 |
| Molecular Weight | 510.15 |
| Flash Point | 332.1±31.5 °C |
| Exact Mass | 507.955109 |
| LogP | 8.59 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.753 |
| InChIKey | YYZPXBXVBQSBDG-IJIVKGSJSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(C=Cc2ccc(Cl)c(Cl)c2)cc1C=Cc1ccc(Cl)c(Cl)c1 |
| Benzene, 1,5-bis[(E)-2-(3,4-dichlorophenyl)ethenyl]-2,4-dinitro- |
| 1,5-Bis[(E)-2-(3,4-dichlorophenyl)vinyl]-2,4-dinitrobenzene |
| 1,5-Bis[(1E)-2-(3,4-dichlorophenyl)ethenyl]-2,4-dinitrobenzene |