Ethanone,2-chloro-1-(2-chloro-10H-phenothiazin-10-yl)- structure
|
Common Name | Ethanone,2-chloro-1-(2-chloro-10H-phenothiazin-10-yl)- | ||
|---|---|---|---|---|
| CAS Number | 16189-69-8 | Molecular Weight | 310.19800 | |
| Density | 1.468g/cm3 | Boiling Point | 539.9ºC at 760mmHg | |
| Molecular Formula | C14H9Cl2NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.3ºC | |
| Name | 2-chloro-1-(2-chlorophenothiazin-10-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 539.9ºC at 760mmHg |
| Molecular Formula | C14H9Cl2NOS |
| Molecular Weight | 310.19800 |
| Flash Point | 280.3ºC |
| Exact Mass | 308.97800 |
| PSA | 45.61000 |
| LogP | 4.77310 |
| Vapour Pressure | 1.01E-11mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | FXCKKLUGQMWBDD-UHFFFAOYSA-N |
| SMILES | O=C(CCl)N1c2ccccc2Sc2ccc(Cl)cc21 |
| HS Code | 2934300000 |
|---|
|
~76%
Ethanone,2-chlo... CAS#:16189-69-8 |
| Literature: MT. SINAI SCHOOL OF MEDICINE; OHLMEYER, Michael; NARLA, Goutham; DHAWAN, Neil; KASTRINSKY, David Patent: WO2013/25882 A2, 2013 ; Location in patent: Paragraph 00114 ; |
|
~%
Ethanone,2-chlo... CAS#:16189-69-8 |
| Literature: Shurawlew; Grizenko Zhurnal Obshchei Khimii, 1956 , vol. 26, p. 3385,3386; engl. Ausg. S. 3769, 3770 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-10-chloroacetyl-phenothiazine |
| 2-Chlor-10-chloracetyl-phenothiazin |