1-Boc-4-(2-hydroxymethylphenylamino)piperidine structure
|
Common Name | 1-Boc-4-(2-hydroxymethylphenylamino)piperidine | ||
|---|---|---|---|---|
| CAS Number | 162045-29-6 | Molecular Weight | 306.40000 | |
| Density | 1.163g/cm3 | Boiling Point | 466.398ºC at 760 mmHg | |
| Molecular Formula | C17H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.869ºC | |
| Name | tert-butyl 4-[2-(hydroxymethyl)anilino]piperidine-1-carboxylate |
|---|
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 466.398ºC at 760 mmHg |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.40000 |
| Flash Point | 235.869ºC |
| Exact Mass | 306.19400 |
| PSA | 61.80000 |
| LogP | 3.00120 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | JYEZFXKKAYQZOC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2ccccc2CO)CC1 |
| HS Code | 2933399090 |
|---|
|
~65%
1-Boc-4-(2-hydr... CAS#:162045-29-6 |
| Literature: Tsushima, Masaki; Tadauchi, Kaori; Asai, Kenji; Miike, Naoko; Imai, Masako; Kudo, Toshiaki Patent: US2003/171370 A1, 2003 ; US 20030171370 A1 |
|
~%
1-Boc-4-(2-hydr... CAS#:162045-29-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 41, # 12 p. 2146 - 2163 |
|
~%
1-Boc-4-(2-hydr... CAS#:162045-29-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 41, # 12 p. 2146 - 2163 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |