1-Boc-4-(2-hydroxyethyl)piperidine structure
|
Common Name | 1-Boc-4-(2-hydroxyethyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 89151-44-0 | Molecular Weight | 229.316 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 324.1±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H23NO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 149.8±20.4 °C | |
| Name | 1-Boc-4-(2-hydroxyethyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 324.1±15.0 °C at 760 mmHg |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.316 |
| Flash Point | 149.8±20.4 °C |
| Exact Mass | 229.167801 |
| PSA | 49.77000 |
| LogP | 1.08 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | YBNJZIDYXCGAPX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCO)CC1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(2-Hydroxyethyl)piperidine-1-carboxylic; Acid tert-Butyl Ester |
| 2-Methyl-2-propanyl 4-(2-hydroxyethyl)-1-piperidinecarboxylate |
| MFCD03427086 |
| 1-Piperidinecarboxylic acid, 4-(2-hydroxyethyl)-, 1,1-dimethylethyl ester |
| tert-Butyl 4-(2-hydroxyethyl)piperidine-1-carboxylate |