Benzene,1-methyl-4-[[(1E)-2-phenylethenyl]sulfonyl]- structure
|
Common Name | Benzene,1-methyl-4-[[(1E)-2-phenylethenyl]sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 16212-08-1 | Molecular Weight | 258.33500 | |
| Density | 1.194g/cm3 | Boiling Point | 445.9ºC at 760mmHg | |
| Molecular Formula | C15H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.4ºC | |
| Name | 1-methyl-4-[(E)-2-phenylethenyl]sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 445.9ºC at 760mmHg |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.33500 |
| Flash Point | 276.4ºC |
| Exact Mass | 258.07100 |
| PSA | 42.52000 |
| LogP | 4.52040 |
| Vapour Pressure | 1E-07mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | PIALZYNUNCIZLT-VAWYXSNFSA-N |
| SMILES | Cc1ccc(S(=O)(=O)C=Cc2ccccc2)cc1 |
| HS Code | 2904100000 |
|---|
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| (E)-2-phenyl-1-(4'-tolylsulfonyl)ethene |
| (E)-PhCH=CHSO2C6H4Me-4 |
| 1-methyl-4-[(E)-2-phenylethenyl]sulfonyl-benzene |
| (E)-PhCH=CHSO2(4-Me-C6H4) |
| 1-(4'-methylphenylsulfonyl)-2-phenylethene |
| (E)-1-phenyl-2-(p-toluenesulfonyl)ethene |