Benzene,1,1'-(2,2-dichloroethenylidene)bis- structure
|
Common Name | Benzene,1,1'-(2,2-dichloroethenylidene)bis- | ||
|---|---|---|---|---|
| CAS Number | 2779-69-3 | Molecular Weight | 249.13500 | |
| Density | 1.227g/cm3 | Boiling Point | 315.6ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.2ºC | |
| Name | (2,2-dichloro-1-phenylethenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 315.6ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2 |
| Molecular Weight | 249.13500 |
| Flash Point | 136.2ºC |
| Exact Mass | 248.01600 |
| LogP | 4.88110 |
| Vapour Pressure | 0.000804mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | GVLRAPLHURDGPL-UHFFFAOYSA-N |
| SMILES | ClC(Cl)=C(c1ccccc1)c1ccccc1 |
| HS Code | 2903999090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1-Dichlor-2,2-diphenyl-aethen |
| 1,1-dichloro-2,2-diphenyl-ethene |
| Ethene,1,1-diphenyl-2,2-dichloro |