Serine Hydrolase Inhibitor-19 structure
|
Common Name | Serine Hydrolase Inhibitor-19 | ||
|---|---|---|---|---|
| CAS Number | 1622426-24-7 | Molecular Weight | 296.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24N4O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | Serine Hydrolase Inhibitor-19 |
|---|
| Molecular Formula | C14H24N4O3 |
|---|---|
| Molecular Weight | 296.37 |
| InChIKey | OGWFKBLFWLXJQC-UHFFFAOYSA-N |
| SMILES | Cc1cnn(C(=O)N(C)CCN(C)C(=O)OC(C)(C)C)c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | Missing Phrase - N15.00950417 |
| RIDADR | UN 2811 6.1 / PGIII |
|
Discovery libraries targeting the major enzyme classes: the serine hydrolases.
Bioorg. Med. Chem. Lett. 24(16) , 3807-13, (2014) Two libraries of modestly reactive ureas containing either electron-deficient acyl anilines or acyl pyrazoles were prepared and are reported as screening libraries for candidate serine hydrolase inhib... |