9H-Fluoren-9-one,3-bromo-7-fluoro-2-nitro- structure
|
Common Name | 9H-Fluoren-9-one,3-bromo-7-fluoro-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 16233-11-7 | Molecular Weight | 322.08600 | |
| Density | 1.819g/cm3 | Boiling Point | 450.2ºC at 760 mmHg | |
| Molecular Formula | C13H5BrFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.1ºC | |
| Name | 3-bromo-7-fluoro-2-nitrofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.819g/cm3 |
|---|---|
| Boiling Point | 450.2ºC at 760 mmHg |
| Molecular Formula | C13H5BrFNO3 |
| Molecular Weight | 322.08600 |
| Flash Point | 226.1ºC |
| Exact Mass | 320.94400 |
| PSA | 62.89000 |
| LogP | 4.23100 |
| Vapour Pressure | 2.69E-08mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | XMTJWHNAHDTOMZ-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(F)ccc2-c2cc(Br)c([N+](=O)[O-])cc21 |
|
~%
9H-Fluoren-9-on... CAS#:16233-11-7 |
| Literature: Fletcher,T.L. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 936 - 941 |
| 7-Fluor-3-brom-2-nitro-9-oxo-fluoren |
| 3-bromo-7-fluoro-2-nitro-9h-fluoren-9-one |