9H-Fluoren-9-one,3-ethoxy-2-nitro- structure
|
Common Name | 9H-Fluoren-9-one,3-ethoxy-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 16268-01-2 | Molecular Weight | 269.25200 | |
| Density | 1.365g/cm3 | Boiling Point | 482.8ºC at 760mmHg | |
| Molecular Formula | C15H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9ºC | |
| Name | 3-ethoxy-2-nitrofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 482.8ºC at 760mmHg |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.25200 |
| Flash Point | 224.9ºC |
| Exact Mass | 269.06900 |
| PSA | 72.12000 |
| LogP | 3.72810 |
| Vapour Pressure | 1.78E-09mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | HKQDZVLVGSTSFS-UHFFFAOYSA-N |
| SMILES | CCOc1cc2c(cc1[N+](=O)[O-])C(=O)c1ccccc1-2 |
|
~%
9H-Fluoren-9-on... CAS#:16268-01-2 |
| Literature: Fletcher,T.L. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 936 - 941 |
|
~%
9H-Fluoren-9-on... CAS#:16268-01-2 |
| Literature: Fletcher,T.L. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 936 - 941 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Nitro-3-ethoxy-9-oxo-fluoren |
| 9H-Fluoren-9-one,3-ethoxy-2-nitro |
| 3-ethoxy-2-nitro-9h-fluoren-9-one |