Dithiokohlensaeure-O-ethylester-S-<9-oxo-fluorenyl-(3)-ester> structure
|
Common Name | Dithiokohlensaeure-O-ethylester-S-<9-oxo-fluorenyl-(3)-ester> | ||
|---|---|---|---|---|
| CAS Number | 16233-22-0 | Molecular Weight | 300.39500 | |
| Density | 1.37g/cm3 | Boiling Point | 480.6ºC at 760 mmHg | |
| Molecular Formula | C16H12O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.4ºC | |
| Name | Dithiokohlensaeure-O-ethylester-S-<9-oxo-fluorenyl-(3)-ester> |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 480.6ºC at 760 mmHg |
| Molecular Formula | C16H12O2S2 |
| Molecular Weight | 300.39500 |
| Flash Point | 244.4ºC |
| Exact Mass | 300.02800 |
| PSA | 83.69000 |
| LogP | 4.31150 |
| Vapour Pressure | 2.14E-09mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | NBRTWNCGYVRNCS-UHFFFAOYSA-N |
| SMILES | CCOC(=S)Sc1ccc2c(c1)-c1ccccc1C2=O |
|
~%
Dithiokohlensae... CAS#:16233-22-0 |
| Literature: Fletcher,T.L. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 936 - 941 |
| Benzenecarbothioamide,3-ethoxy |
| 3-ethoxy-thiobenzoic acid amide |
| 3-Aethoxy-thiobenzamid |
| 3-ETHOXYBENZENE-1-CARBOTHIOAMIDE |
| 3-Aethoxythiocarbonylmercapto-fluorenon |
| 3-Aethoxy-thiobenzoesaeure-amid |