2-(4-Octanoylphenyl)ethyl acetate structure
|
Common Name | 2-(4-Octanoylphenyl)ethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 162358-03-4 | Molecular Weight | 290.397 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 406.6±28.0 °C at 760 mmHg | |
| Molecular Formula | C18H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.0±24.0 °C | |
| Name | 2-(4-Octanoylphenyl)ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.6±28.0 °C at 760 mmHg |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.397 |
| Flash Point | 176.0±24.0 °C |
| Exact Mass | 290.188202 |
| PSA | 43.37000 |
| LogP | 4.93 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | YRGCTTARENKHBN-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)c1ccc(CCOC(C)=O)cc1 |
| HS Code | 2915390090 |
|---|
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 1-Octanone, 1-[4-[2-(acetyloxy)ethyl]phenyl]- |
| 2-(4-Octanoylphenyl)ethyl acetate |
| 4-Octanoylphenethyl acetate |