diethyl 2-acetamido-2-[2-(4-octylphenyl)ethyl]propanedioate structure
|
Common Name | diethyl 2-acetamido-2-[2-(4-octylphenyl)ethyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 162358-08-9 | Molecular Weight | 433.581 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 570.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H39NO5 | Melting Point | 57-58ºC | |
| MSDS | N/A | Flash Point | 299.0±30.1 °C | |
| Name | diethyl 2-acetamido-2-[2-(4-octylphenyl)ethyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 570.7±50.0 °C at 760 mmHg |
| Melting Point | 57-58ºC |
| Molecular Formula | C25H39NO5 |
| Molecular Weight | 433.581 |
| Flash Point | 299.0±30.1 °C |
| Exact Mass | 433.282837 |
| PSA | 81.70000 |
| LogP | 7.26 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | RYOKCHIAMHPMLV-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1ccc(CCC(NC(C)=O)(C(=O)OCC)C(=O)OCC)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Diethyl acetamido[2-(4-octylphenyl)ethyl]malonate |
| diethyl 2-(acetylamino)-2-(2-(4-n-octylphenyl)ethyl)malonate |
| Diethyl 2-(Acetamido)-2-(2-(4-octylphenyl)ethyl)propanedioate |
| diethyl acetamido-2-(4-octylphenyl)ethylmalonate |
| Diethyl 2-Acetamido-2-[2-(4-octylphenylethyl)malonate |
| diethyl 2-acetamido-2-(4-octylphenethyl)malonate |
| Propanedioic acid, 2-(acetylamino)-2-[2-(4-octylphenyl)ethyl]-, diethyl ester |
| diethyl 2-acetylamino-2-(2-(4-octylphenyl)ethyl)propane-1,3-dioate |
| 2-(Acetylamino)-2-[2-(4-octylphenyl)ethyl]propanedioic acid diethyl ester |