[2-(11,17-dihydroxy-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate structure
|
Common Name | [2-(11,17-dihydroxy-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 1625-11-2 | Molecular Weight | 418.52300 | |
| Density | 1.24g/cm3 | Boiling Point | 579.6ºC at 760 mmHg | |
| Molecular Formula | C24H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.5ºC | |
| Name | [2-(11,17-dihydroxy-6,10,13-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 579.6ºC at 760 mmHg |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.52300 |
| Flash Point | 194.5ºC |
| Exact Mass | 418.23600 |
| PSA | 100.90000 |
| LogP | 2.59840 |
| Vapour Pressure | 7.59E-16mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | ZWEFPCOQVDIOJD-LFYFAGGJSA-N |
| SMILES | CC(=O)OCC(=O)C1(O)CCC2C3CC(C)C4=CC(=O)CCC4(C)C3C(O)CC21C |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 11|A,17,21-Trihydroxy-16|A-methyl-pregna-1,4-diene-3,20-dione 21-Acetate |