dimethyl 9,10-dihydro-9,10-ethenoanthracene-11,12-dicarboxylate structure
|
Common Name | dimethyl 9,10-dihydro-9,10-ethenoanthracene-11,12-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 1625-82-7 | Molecular Weight | 320.33900 | |
| Density | 1.296g/cm3 | Boiling Point | 444.3ºC at 760 mmHg | |
| Molecular Formula | C20H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8ºC | |
| Name | dimethyl 9,10-dihydro-9,10-ethenoanthracene-11,12-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 444.3ºC at 760 mmHg |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.33900 |
| Flash Point | 222.8ºC |
| Exact Mass | 320.10500 |
| PSA | 52.60000 |
| LogP | 2.92000 |
| Vapour Pressure | 4.32E-08mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | ITJNGTUROSCESK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=O)OC)C2c3ccccc3C1c1ccccc12 |
|
~88%
dimethyl 9,10-d... CAS#:1625-82-7 |
| Literature: Muehlebach, Michel; Neuenschwander, Markus; Engel, Peter Helvetica Chimica Acta, 1993 , vol. 76, p. 2089 - 2110 |
|
~%
dimethyl 9,10-d... CAS#:1625-82-7 |
| Literature: Wilcox, Craig S.; Greer, Laurie M.; Lynch, Vincent Journal of the American Chemical Society, 1987 , vol. 109, # 6 p. 1865 - 1867 |
|
~%
dimethyl 9,10-d... CAS#:1625-82-7 |
| Literature: Diels; Thiele Chemische Berichte, 1938 , vol. 71, p. 1173,1176 |
| 9,10-Anthracenedicarboxylic acid,dimethyl ester |
| Anthracen-9,10-dicarbonsaeure-dimethylester |
| 9,10-dicarbomethoxyanthracene |
| dimethyl 9,10-anthracenedicarboxylate |
| Dimethyl 9,10-dihydro-9,10-ethenoanthracene-11,12-dicarboxylate |
| dimethyl 9,10-dihydro-9,10-etheno-11,12-anthracenedicarboxylate |