9,10-Ethenoanthracene-11,12-dicarboxylicacid, 9,10-dihydro- structure
|
Common Name | 9,10-Ethenoanthracene-11,12-dicarboxylicacid, 9,10-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 1625-81-6 | Molecular Weight | 292.28500 | |
| Density | 1.488g/cm3 | Boiling Point | 521.3ºC at 760mmHg | |
| Molecular Formula | C18H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.1ºC | |
| Name | 9,10-Ethenoanthracene-11,12-dicarboxylic acid, 9,10-dihydro |
|---|---|
| Synonym | More Synonyms |
| Density | 1.488g/cm3 |
|---|---|
| Boiling Point | 521.3ºC at 760mmHg |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.28500 |
| Flash Point | 283.1ºC |
| Exact Mass | 292.07400 |
| PSA | 74.60000 |
| LogP | 2.74320 |
| Vapour Pressure | 1.08E-11mmHg at 25°C |
| Index of Refraction | 1.719 |
| InChIKey | AMYJGIMSOTUULB-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=C(C(=O)O)C2c3ccccc3C1c1ccccc12 |
| HS Code | 2917399090 |
|---|
|
~97%
9,10-Ethenoanth... CAS#:1625-81-6 |
| Literature: Muehlebach, Michel; Neuenschwander, Markus; Engel, Peter Helvetica Chimica Acta, 1993 , vol. 76, p. 2089 - 2110 |
|
~%
9,10-Ethenoanth... CAS#:1625-81-6 |
| Literature: Figeys,H.P.; Dralants,A. Tetrahedron, 1972 , vol. 28, p. 3031 - 3036 |
|
~%
9,10-Ethenoanth... CAS#:1625-81-6 |
| Literature: Vaughan; Milton Journal of the American Chemical Society, 1952 , vol. 74, p. 5623,5626 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9,10-dihydro-9,10-etheno-11,12-anthracenedicarboxylic acid |
| 9,10-dihydro-9,10-ethenoanthracene-11,12-dicarboxylic acid |