Stannane,[1,1'-biphenyl]-4-yltrimethyl structure
|
Common Name | Stannane,[1,1'-biphenyl]-4-yltrimethyl | ||
|---|---|---|---|---|
| CAS Number | 1625-95-2 | Molecular Weight | 317.00400 | |
| Density | N/A | Boiling Point | 331.1ºC at 760 mmHg | |
| Molecular Formula | C15H18Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-(4-phenylphenyl)stannane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 331.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H18Sn |
| Molecular Weight | 317.00400 |
| Flash Point | 158.2ºC |
| Exact Mass | 318.04300 |
| LogP | 3.89880 |
| Vapour Pressure | 0.000307mmHg at 25°C |
| InChIKey | UYYWBYONQQFPFP-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)c1ccc(-c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
Stannane,[1,1'-... CAS#:1625-95-2 |
| Literature: Chopa, Alicia B.; Lockhart, Maria T.; Dorn, Viviana B. Organometallics, 2002 , vol. 21, # 7 p. 1425 - 1429 |
|
~10%
Stannane,[1,1'-... CAS#:1625-95-2 |
| Literature: Gmelin Handbook: Sn: Org.Verb.2, 1.1.2.1.12, page 146 - 152 |
|
~39%
Stannane,[1,1'-... CAS#:1625-95-2 |
| Literature: Gmelin Handbook: Sn: Org.Verb.2, 1.1.2.1.12, page 146 - 152 |
|
~51%
Stannane,[1,1'-... CAS#:1625-95-2 |
| Literature: Gmelin Handbook: Sn: Org.Verb.2, 1.1.2.1.12, page 146 - 152 |
|
~%
Stannane,[1,1'-... CAS#:1625-95-2 |
| Literature: Gmelin Handbook: Sn: Org.Verb.2, 1.1.2.1.12, page 146 - 152 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 3 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of trimethyl-(4-phenylphenyl)stannane? |
| A: Molecular weight of trimethyl-(4-phenylphenyl)stannane is 317.00400. |
| Q: What is the LogP of trimethyl-(4-phenylphenyl)stannane? |
| A: LogP of trimethyl-(4-phenylphenyl)stannane is 3.89880. |
| Q: What is the InChIKey of trimethyl-(4-phenylphenyl)stannane? |
| A: InChIKey of trimethyl-(4-phenylphenyl)stannane is UYYWBYONQQFPFP-UHFFFAOYSA-N. |
| Q: What is the CAS number of trimethyl-(4-phenylphenyl)stannane? |
| A: CAS number of trimethyl-(4-phenylphenyl)stannane is 1625-95-2. |
| Q: What is the English name of trimethyl-(4-phenylphenyl)stannane? |
| A: The English name of trimethyl-(4-phenylphenyl)stannane is trimethyl-(4-phenylphenyl)stannane. |
| Q: What are the upstream materials of trimethyl-(4-phenylphenyl)stannane? |
| A: Related upstream materials(CAS) of trimethyl-(4-phenylphenyl)stannane: 37782-03-9;1066-45-1;1201-71-4;3315-91-1;1066-44-0. |
| Q: What are the downstream products of trimethyl-(4-phenylphenyl)stannane? |
| A: Related downstream products(CAS) of trimethyl-(4-phenylphenyl)stannane: 1625-94-1;594-27-4;13041-66-2. |
| Q: What is the molecular formula of trimethyl-(4-phenylphenyl)stannane? |
| A: Molecular formula of trimethyl-(4-phenylphenyl)stannane is C15H18Sn. |
| Q: What is the Chinese name of 1625-95-2? |
| A: Chinese name of 1625-95-2 is 1625-95-2. |
| Q: What is the boiling point of trimethyl-(4-phenylphenyl)stannane? |
| A: Boiling point of trimethyl-(4-phenylphenyl)stannane is 331.1ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |