1,4-Diethoxy-2,3,5,6-tetrafluorobenzene structure
|
Common Name | 1,4-Diethoxy-2,3,5,6-tetrafluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 16251-00-6 | Molecular Weight | 238.17900 | |
| Density | 1.271g/cm3 | Boiling Point | 220ºC at 760mmHg | |
| Molecular Formula | C10H10F4O2 | Melting Point | 49-49.5ºC | |
| MSDS | N/A | Flash Point | 93.6ºC | |
| Name | 1,4-Diethoxy-2,3,5,6-tetrafluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.271g/cm3 |
|---|---|
| Boiling Point | 220ºC at 760mmHg |
| Melting Point | 49-49.5ºC |
| Molecular Formula | C10H10F4O2 |
| Molecular Weight | 238.17900 |
| Flash Point | 93.6ºC |
| Exact Mass | 238.06200 |
| PSA | 18.46000 |
| LogP | 3.04040 |
| Vapour Pressure | 0.171mmHg at 25°C |
| Index of Refraction | 1.434 |
| InChIKey | WVVPQTTXYYMGIK-UHFFFAOYSA-N |
| SMILES | CCOc1c(F)c(F)c(OCC)c(F)c1F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,4-diethoxy-2,3,5,6-tetrafluorobenzene |