Fmoc-Photo-Linker structure
|
Common Name | Fmoc-Photo-Linker | ||
|---|---|---|---|---|
| CAS Number | 162827-98-7 | Molecular Weight | 520.53100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H28N2O8 | Melting Point | 199-203ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-[1-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-2-methoxy-5-nitrophenoxy]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 199-203ºC |
|---|---|
| Molecular Formula | C28H28N2O8 |
| Molecular Weight | 520.53100 |
| Exact Mass | 520.18500 |
| PSA | 139.91000 |
| LogP | 6.36080 |
| InChIKey | JWESTWISAMMBBU-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)NC(=O)OCC2c3ccccc3-c3ccccc32)c([N+](=O)[O-])cc1OCCCC(=O)O |
|
~%
Fmoc-Photo-Linker CAS#:162827-98-7 |
| Literature: Holmes, Christopher P.; Jones, David G. Journal of Organic Chemistry, 1995 , vol. 60, # 8 p. 2318 - 2319 |
|
~%
Fmoc-Photo-Linker CAS#:162827-98-7 |
| Literature: Holmes, Christopher P. Journal of Organic Chemistry, 1997 , vol. 62, # 8 p. 2370 - 2380 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-[4-(1-(Fmoc-amino)ethyl)-2-methoxy-5-nitrophenoxy]butanoic acid |
| 4-{4-[1-[(9H-FLUOREN-9-YLMETHOXY CARBONYL)AMINO]ETHYL]-2-METHOXY-5-NITROPHENOXY}BUTANOIC ACID |
| 4-{4-[1-(9-fluorenylmethyloxycarbonylamino)ethyl]-2-methoxy-5-nitrophenoxy}butanoic acid |
| (4-[4-1-(9-fluorenylmethoxycarbonyl-amino)ethyl]-2-methoxy-5-nitro-phenoxy)butanoic acid |
| AmbotzRL-1026 |