BAPO structure
|
Common Name | BAPO | ||
|---|---|---|---|---|
| CAS Number | 162881-26-7 | Molecular Weight | 418.465 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 590.0±60.0 °C at 760 mmHg | |
| Molecular Formula | C26H27O3P | Melting Point | 131-135ºC | |
| MSDS | Chinese USA | Flash Point | 310.6±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Phenylbis(2,4,6-trimethylbenzoyl)phosphine oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 590.0±60.0 °C at 760 mmHg |
| Melting Point | 131-135ºC |
| Molecular Formula | C26H27O3P |
| Molecular Weight | 418.465 |
| Flash Point | 310.6±32.9 °C |
| Exact Mass | 418.169769 |
| PSA | 61.02000 |
| LogP | 5.49 |
| Appearance of Characters | powder |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | GUCYFKSBFREPBC-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C(=O)P(=O)(C(=O)c2c(C)cc(C)cc2C)c2ccccc2)c(C)c1 |
| Water Solubility | acetone, acetonitrile, toluene, and hexanedioldiacrylate: soluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H413 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R43;R53 |
| Safety Phrases | S22-S24-S37-S61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | - |
| HS Code | 29319090 |
|
Vertical Flow Lithography for Fabrication of 3D Anisotropic Particles.
Small 11 , 6391-6, (2016) A microfluidics-based method for the 3D fabrication of anisotropic particles is reported. The method uses a vertical microchannel where tunable light patterns solidify photocurable resins for stacking... |
|
|
Kolczak, U. et al.
J. Am. Chem. Soc. 118 , 6477, (1996)
|
| 1R C1 E1 BVPO&R&VR B1 D1 F1 |
| EINECS 423-340-5 |
| (Phenylphosphoryl)bis(mesitylmethanone) |
| Photoinitiator XBPO |
| Methanone, [phenyl(2,4,6-trimethylbenzoyl)phosphinyl](2,4,6-trimethylphenyl)- |
| bis(2,4,6-trimethylbenzoyl)phenylphosphine oxide |
| MFCD01863675 |
| BAPO |