1,3-DICHLORO-2,4,6-TRINITROBENZENE structure
|
Common Name | 1,3-DICHLORO-2,4,6-TRINITROBENZENE | ||
|---|---|---|---|---|
| CAS Number | 1630-09-7 | Molecular Weight | 281.99500 | |
| Density | 1.894g/cm3 | Boiling Point | 380ºC at 760mmHg | |
| Molecular Formula | C6HCl2N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.6ºC | |
| Name | 2,4-Dichloro-1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.894g/cm3 |
|---|---|
| Boiling Point | 380ºC at 760mmHg |
| Molecular Formula | C6HCl2N3O6 |
| Molecular Weight | 281.99500 |
| Flash Point | 183.6ºC |
| Exact Mass | 280.92400 |
| PSA | 137.46000 |
| LogP | 4.28760 |
| Vapour Pressure | 1.23E-05mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | VNOJQYPHLMLHGQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Cl)c([N+](=O)[O-])c1Cl |
| HS Code | 2904909090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 6 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4-dichloro-1,3,5-trinitro-benzene |
| 2,3:4,5-DI-O-ISOPROPYLIDENE-B-D-FRUCTOPYRANOSE-D12 |
| Benzene,2,4-dichloro-1,3,5-trinitro |
| styphnyl chloride |
| 1,3-Dichlor-2,4,6-trinitro-benzol |
| 1,3,5-Trinitro-2,4-dichlor-benzol |
| 1,3-Dichloro-2,4,6-trinitrobenzene |
| 2,4-Dichlor-1,3,5-trinitro-benzol |