3,5-dichloro-2,4,6-trifluorobenzotrifluoride structure
|
Common Name | 3,5-dichloro-2,4,6-trifluorobenzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 4284-10-0 | Molecular Weight | 268.97100 | |
| Density | 1.715 | Boiling Point | 167 °C | |
| Molecular Formula | C7Cl2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 67.4ºC | |
| Name | 3,5-dichloro-2,4,6-trifluorobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.715 |
|---|---|
| Boiling Point | 167 °C |
| Molecular Formula | C7Cl2F6 |
| Molecular Weight | 268.97100 |
| Flash Point | 67.4ºC |
| Exact Mass | 267.92800 |
| LogP | 4.42950 |
| Index of Refraction | 1.4456 |
| InChIKey | GMAAQKFDAJMAFP-UHFFFAOYSA-N |
| SMILES | Fc1c(Cl)c(F)c(C(F)(F)F)c(F)c1Cl |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2903999090 |
|
~%
3,5-dichloro-2,... CAS#:4284-10-0 |
| Literature: Igumnov, Sergei Mikhailovich Patent: US6265627 B1, 2001 ; |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3-dichloro-2,4,6-trifluoro-5-(trifluoromethyl)benzene |
| 3,5-Dichloro-α,α,α,2,4,6-hexafluorotoluene |
| MFCD00039304 |
| 2,4-Dichloro-1,3,5-trifluoro-4-(trifluoromethyl)benzene |
| 3,5-Dichloro-2,4,6-trifluorobenzotrifluoride |