tert-butyl-dimethyl-thiophen-2-ylsilane structure
|
Common Name | tert-butyl-dimethyl-thiophen-2-ylsilane | ||
|---|---|---|---|---|
| CAS Number | 163079-25-2 | Molecular Weight | 198.40000 | |
| Density | 0.929 g/mL at 25ºC | Boiling Point | 40-45ºC/0.2 mmHg | |
| Molecular Formula | C10H18SSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 77ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-butyl-dimethyl-thiophen-2-ylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.929 g/mL at 25ºC |
|---|---|
| Boiling Point | 40-45ºC/0.2 mmHg |
| Molecular Formula | C10H18SSi |
| Molecular Weight | 198.40000 |
| Flash Point | 77ºC |
| Exact Mass | 198.09000 |
| PSA | 28.24000 |
| LogP | 3.46360 |
| InChIKey | HDERSDBULDLBGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)c1cccs1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H413 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2934999090 |
|
~97%
tert-butyl-dime... CAS#:163079-25-2 |
| Literature: Loft, Michael S.; Mowlem, Timothy J.; Widdowson, David A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1995 , # 2 p. 97 - 104 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Silane,(1,1-dimethylethyl)dimethyl-2-thienyl-(9CI) |
| 2-(TERT-BUTYLDIMETHYLSILYL)THIOPHENE |
| 2-(Dimethyl-tert-butylsilyl)thiophene |
| Thiophene,2-[(1,1-dimethylethyl)dimethylsilyl] |