Orbofiban structure
|
Common Name | Orbofiban | ||
|---|---|---|---|---|
| CAS Number | 163250-90-6 | Molecular Weight | 361.39600 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H23N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OrbofibanOrbofiban is an orally active platelet GPIIb/IIIa antagonist that inhibits platelet aggregation. |
| Name | ethyl 3-[[(3S)-1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Orbofiban is an orally active platelet GPIIb/IIIa antagonist that inhibits platelet aggregation. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C17H23N5O4 |
| Molecular Weight | 361.39600 |
| Exact Mass | 361.17500 |
| PSA | 141.10000 |
| LogP | 1.78870 |
| Index of Refraction | 1.621 |
| InChIKey | VJDOPFARMOLELX-ZDUSSCGKSA-N |
| SMILES | CCOC(=O)CCNC(=O)NC1CCN(c2ccc(C(=N)N)cc2)C1=O |
| Orbofiban |
| Orbofiban [INN] |
| UNII-FGJ53JS7PT |