Orbofiban acetate structure
|
Common Name | Orbofiban acetate | ||
|---|---|---|---|---|
| CAS Number | 163250-91-7 | Molecular Weight | 421.45 | |
| Density | N/A | Boiling Point | 776.9ºC at 760 mmHg | |
| Molecular Formula | C19H27N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 423.7ºC | |
Use of Orbofiban acetateOrbofiban acetate is an orally active platelet GPIIb/IIIa antagonist that inhibits platelet aggregation. |
| Name | acetic acid,ethyl 3-[[(3S)-1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Orbofiban acetate is an orally active platelet GPIIb/IIIa antagonist that inhibits platelet aggregation. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 776.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H27N5O6 |
| Molecular Weight | 421.45 |
| Flash Point | 423.7ºC |
| Exact Mass | 421.19600 |
| PSA | 178.40000 |
| LogP | 1.87960 |
| Vapour Pressure | 2.09E-25mmHg at 25°C |
| InChIKey | PKHRWVBUJHJCLV-ZOWNYOTGSA-N |
| SMILES | CC(=O)O.CCOC(=O)CCNC(=O)NC1CCN(c2ccc(C(=N)N)cc2)C1=O |
| ethyl 3-[[(3S)-1-(4-carbamimidoylphenyl)-2-oxo-pyrrolidin-3-yl]carbamoylamino]propanoate |
| CS-511 |
| Orbofiban acetate |