2,4-Dichloro-6-(4-methoxyphenyl)pyrimidine structure
|
Common Name | 2,4-Dichloro-6-(4-methoxyphenyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 163263-91-0 | Molecular Weight | 255.100 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 395.7±32.0 °C at 760 mmHg | |
| Molecular Formula | C11H8Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.1±25.1 °C | |
| Name | 2,4-Dichloro-6-(4-methoxyphenyl)pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.7±32.0 °C at 760 mmHg |
| Molecular Formula | C11H8Cl2N2O |
| Molecular Weight | 255.100 |
| Flash Point | 193.1±25.1 °C |
| Exact Mass | 254.001373 |
| PSA | 35.01000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | QYHGNJWTEXUEGF-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(Cl)nc(Cl)n2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrimidine, 2,4-dichloro-6-(4-methoxyphenyl)- |
| rb3271 |
| 2,4-Dichloro-6-(4-methoxyphenyl)pyrimidine |