(S)-(+)-N-(1-(1-NAPHTHYL)ETHYL)PHTHALAM& structure
|
Common Name | (S)-(+)-N-(1-(1-NAPHTHYL)ETHYL)PHTHALAM& | ||
|---|---|---|---|---|
| CAS Number | 163438-06-0 | Molecular Weight | 319.35400 | |
| Density | 1.255g/cm3 | Boiling Point | 582ºC at 760mmHg | |
| Molecular Formula | C20H17NO3 | Melting Point | 167ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 305.8ºC | |
| Name | 2-[[(1S)-1-naphthalen-1-ylethyl]carbamoyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 582ºC at 760mmHg |
| Melting Point | 167ºC (dec.)(lit.) |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.35400 |
| Flash Point | 305.8ºC |
| Exact Mass | 319.12100 |
| PSA | 69.89000 |
| LogP | 4.60380 |
| Vapour Pressure | 2.18E-14mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | ZEKKAEAOTSMLNW-ZDUSSCGKSA-N |
| SMILES | CC(NC(=O)c1ccccc1C(=O)O)c1cccc2ccccc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD00192339 |
| (S)-(+)-N-[1-(1-Naphthyl)ethyl]phthalamic acid |