ethyl nonafluorobutyl ether structure
|
Common Name | ethyl nonafluorobutyl ether | ||
|---|---|---|---|---|
| CAS Number | 163702-05-4 | Molecular Weight | 264.08900 | |
| Density | 1.428 g/mL at 25 °C(lit.) | Boiling Point | 76 °C(lit.) | |
| Molecular Formula | C6H5F9O | Melting Point | −138 °C(lit.) | |
| MSDS | N/A | Flash Point | 39 °F | |
| Name | 1-(Ethoxy)nonafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.428 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 76 °C(lit.) |
| Melting Point | −138 °C(lit.) |
| Molecular Formula | C6H5F9O |
| Molecular Weight | 264.08900 |
| Flash Point | 39 °F |
| Exact Mass | 264.02000 |
| PSA | 9.23000 |
| LogP | 3.44860 |
| Appearance of Characters | NA |
| Vapour Pressure | 156mmHg at 25°C |
| Index of Refraction | n20/D 1.282(lit.) |
| InChIKey | DFUYAWQUODQGFF-UHFFFAOYSA-N |
| SMILES | CCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | F: Flammable;Xn: Harmful; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | S16-S23-S45 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| MFCD01862062 |
| ethyl nonafluorobutyl ether |
| (Perfluorobutoxy)ethane |