N4-Benzoyl-5'-O-DMT-2'-O-methylcytidine 3'-CE phosphoramidite structure
|
Common Name | N4-Benzoyl-5'-O-DMT-2'-O-methylcytidine 3'-CE phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 163759-94-2 | Molecular Weight | 863.933 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C47H54N5O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N4-Benzoyl-5'-O-DMT-2'-O-methylcytidine 3'-CE phosphoramidite2'-O-MOE-5-Me-C (Bz) is a nucleotide for the stereoselective synthesis of nucleoside alkyl phosphonates[1]. |
| Name | N4-Benzoyl-5'-O-DMT-2'-O-methylcytidine 3'-CE phosphoramidite |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-O-MOE-5-Me-C (Bz) is a nucleotide for the stereoselective synthesis of nucleoside alkyl phosphonates[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C47H54N5O9P |
|---|---|
| Molecular Weight | 863.933 |
| Exact Mass | 863.365906 |
| LogP | 9.98 |
| Appearance of Characters | Powder |
| InChIKey | FLIGVMLIIDVDSN-UHFFFAOYSA-N |
| SMILES | COCCOC1C(OP(OCCC#N)N(C(C)C)C(C)C)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)OC1n1cc(C)c(NC(=O)c2ccccc2)nc1=O |
| N-Benzoyl-5'-O-[bis(4-methoxyphenyl)(phenyl)methyl]-3'-O-[(2-cyanoethoxy)(diisopropylamino)phosphino]-2'-O-methylcytidine |
| Cytidine, N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-3'-O-[[bis(1-methylethyl)amino](2-cyanoethoxy)phosphino]-2'-O-methyl- |