Butanamide,N-(1,3-benzodioxol-5-ylmethyl)-3-oxo- structure
|
Common Name | Butanamide,N-(1,3-benzodioxol-5-ylmethyl)-3-oxo- | ||
|---|---|---|---|---|
| CAS Number | 16386-35-9 | Molecular Weight | 235.23600 | |
| Density | 1.264g/cm3 | Boiling Point | 468ºC at 760mmHg | |
| Molecular Formula | C12H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.9ºC | |
| Name | N-(1,3-benzodioxol-5-ylmethyl)-3-oxobutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 468ºC at 760mmHg |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.23600 |
| Flash Point | 236.9ºC |
| Exact Mass | 235.08400 |
| PSA | 64.63000 |
| LogP | 1.40150 |
| Vapour Pressure | 6.19E-09mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | WNOBCCBHRGNWFB-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NCc1ccc2c(c1)OCO2 |
| HS Code | 2932999099 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(benzo[d][1,3]dioxol-5-ylmethyl)-3-oxobutanamide |
| N-PIPERONYLACETOACETAMIDE |
| N-(2H-1,3-benzodioxol-5-ylmethyl)-3-oxobutanamide |