WAY-637664 structure
|
Common Name | WAY-637664 | ||
|---|---|---|---|---|
| CAS Number | 353522-37-9 | Molecular Weight | 336.38 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 627.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.1±31.5 °C | |
Use of WAY-637664InhA inhibitors; altering the lifespan of a eukaryotic organism; |
| Name | WAY-637664 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 627.1±55.0 °C at 760 mmHg |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.38 |
| Flash Point | 333.1±31.5 °C |
| Exact Mass | 336.147400 |
| LogP | 3.15 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | TYQLLUAATDLSNH-UHFFFAOYSA-N |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)NCc1ccc2c(c1)OCO2 |
| N-(1,3-Benzodioxol-5-ylmethyl)-4-(1H-indol-3-yl)butanamide |
| 1H-Indole-3-butanamide, N-(1,3-benzodioxol-5-ylmethyl)- |