Mifanertinib structure
|
Common Name | Mifanertinib | ||
|---|---|---|---|---|
| CAS Number | 1639014-72-4 | Molecular Weight | 465.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19ClF3N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MifanertinibMifanertinib is a potent tyrosine kinase inhibitor with antineoplastic activity[1]. |
| Name | Mifanertinib |
|---|
| Description | Mifanertinib is a potent tyrosine kinase inhibitor with antineoplastic activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H19ClF3N5O2 |
|---|---|
| Molecular Weight | 465.86 |
| InChIKey | QPACRWFSFWQNOZ-ONEGZZNKSA-N |
| SMILES | CN(C)CC=CC(=O)Nc1cc2c(Nc3ccc(F)c(Cl)c3)ncnc2cc1OC(F)F |