Ethyl bis(trimethylsilyl)-phosphate structure
|
Common Name | Ethyl bis(trimethylsilyl)-phosphate | ||
|---|---|---|---|---|
| CAS Number | 1641-57-2 | Molecular Weight | 254.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H23O3PSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [ethyl(trimethylsilyloxy)phosphoryl]oxy-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H23O3PSi2 |
|---|---|
| Molecular Weight | 254.41100 |
| Exact Mass | 254.09200 |
| PSA | 45.34000 |
| LogP | 3.90240 |
| InChIKey | PNTLUCJSQZGZBN-UHFFFAOYSA-N |
| SMILES | CCP(=O)(O[Si](C)(C)C)O[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Ethylphosphonsaeure-di-(trimethylsilylester) |
| Ethylphosphonsaeure-bis-trimethylsilylester |
| bis(trimethylsilyl) ethylphosphonate |
| Phosphonic acid,ethyl-,bis(trimethylsilyl) ester |
| O,O-bis(Trimethylsilyl)ethanephosphonate |