Ethylbis(trimethylsilyl)amine structure
|
Common Name | Ethylbis(trimethylsilyl)amine | ||
|---|---|---|---|---|
| CAS Number | 2477-39-6 | Molecular Weight | 189.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H23NSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-bis(trimethylsilyl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H23NSi2 |
|---|---|
| Molecular Weight | 189.44600 |
| Exact Mass | 189.13700 |
| PSA | 3.24000 |
| LogP | 2.97810 |
| InChIKey | OGWVYCFORNDBRE-UHFFFAOYSA-N |
| SMILES | CCN([Si](C)(C)C)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
|
~99%
Ethylbis(trimet... CAS#:2477-39-6 |
| Literature: Dynamit Nobel Aktiengesellschaft Patent: US4115427 A1, 1978 ; |
|
~71%
Ethylbis(trimet... CAS#:2477-39-6 |
| Literature: Bestmann, Hans Juergen; Woelfel, Gerhard Chemische Berichte, 1984 , vol. 117, # 3 p. 1250 - 1254 |
|
~89%
Ethylbis(trimet... CAS#:2477-39-6 |
| Literature: Betsmann, Hans Juergen; Woelfel, Gerhard; Mederer, Karl Synthesis, 1987 , # 9 p. 848 - 850 |
|
~79%
Ethylbis(trimet... CAS#:2477-39-6 |
| Literature: Bestmann, Hans Juergen; Woelfel, Gerhard Chemische Berichte, 1984 , vol. 117, # 3 p. 1250 - 1254 |
|
~%
Ethylbis(trimet... CAS#:2477-39-6 |
| Literature: Bestmann, Hans Juergen; Woelfel, Gerhard Angewandte Chemie, 1984 , vol. 96, # 1 p. 52 |
|
~%
Ethylbis(trimet... CAS#:2477-39-6 |
| Literature: Ruehlmann,K. Chemische Berichte, 1961 , vol. 94, p. 2311 - 2313 |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Aethyl-di-(trimethyl-silyl)-amin |
| Ethylbis(trimethylsilyl)amine |
| N-ethylhexamethyldisilazane |
| Ethyl<bis(trimethylsilyl)>amin |
| Silanamine,N-ethyl-1,1,1-trimethyl-N-(trimethylsilyl) |
| N,N-Bis(trimethylsilyl)ethylamin |
| 2-ethyl-1,1,1,3,3,3-hexamethyl-disilazane |
| N,N-Bis-trimethylsilyl-aethylamin |