1H-Isoindole-1,3(2H)-dione,2-[(1,1-dioxido-3-oxo-1,2-benzisothiazol-2(3H)-yl)methyl] structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-[(1,1-dioxido-3-oxo-1,2-benzisothiazol-2(3H)-yl)methyl] | ||
|---|---|---|---|---|
| CAS Number | 16417-22-4 | Molecular Weight | 342.32600 | |
| Density | 1.639g/cm3 | Boiling Point | 572.5ºC at 760mmHg | |
| Molecular Formula | C16H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.1ºC | |
| Name | 2-[(1,1,3-trioxo-1,2-benzothiazol-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.639g/cm3 |
|---|---|
| Boiling Point | 572.5ºC at 760mmHg |
| Molecular Formula | C16H10N2O5S |
| Molecular Weight | 342.32600 |
| Flash Point | 300.1ºC |
| Exact Mass | 342.03100 |
| PSA | 100.21000 |
| LogP | 2.04140 |
| Vapour Pressure | 4.08E-13mmHg at 25°C |
| Index of Refraction | 1.723 |
| InChIKey | MUBJXZVRYCWZJZ-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CN1C(=O)c2ccccc2S1(=O)=O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibition of human carbonic anhydrase 12 by stopped-flow CO2 hydrase assay
Source: ChEMBL
Target: Carbonic anhydrase 12
External Id: CHEMBL3129538
|
|
Name: Inhibition of human carbonic anhydrase 9 by stopped-flow CO2 hydrase assay
Source: ChEMBL
Target: Carbonic anhydrase 9
External Id: CHEMBL3129539
|
|
Name: Inhibition of human carbonic anhydrase 1 by stopped-flow CO2 hydrase assay
Source: ChEMBL
Target: Carbonic anhydrase 1
External Id: CHEMBL3129540
|
|
Name: Inhibition of human carbonic anhydrase 2 by stopped-flow CO2 hydrase assay
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL3129541
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| N-(Phthalimidomethyl)-saccharin |
| 2-((1,1-dioxido-3-oxobenzo[d]isothiazol-2(3H)-yl)methyl)isoindoline-1,3-dione |