2-(2-hydroxyacetyl)-1,8-dimethylimidazo[1,2-a]quinoxalin-4(5H)-one structure
|
Common Name | 2-(2-hydroxyacetyl)-1,8-dimethylimidazo[1,2-a]quinoxalin-4(5H)-one | ||
|---|---|---|---|---|
| CAS Number | 164329-73-1 | Molecular Weight | 257.24500 | |
| Density | 1.543g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxyacetyl)-1,8-dimethylimidazo[1,2-a]quinoxalin-4(5H)-one |
|---|
| Density | 1.543g/cm3 |
|---|---|
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.24500 |
| Exact Mass | 257.08000 |
| PSA | 87.46000 |
| LogP | 1.49080 |
| Index of Refraction | 1.737 |
| InChIKey | SLVGWYSZEWCQAI-UHFFFAOYSA-N |
| SMILES | Cc1ccc2[nH]c(=O)c3nc(C(=O)O)c(C)n3c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
2-(2-hydroxyace... CAS#:164329-73-1 |
| Literature: Bristol-Myers Squibb Company Patent: US6869956 B2, 2005 ; |
|
~%
2-(2-hydroxyace... CAS#:164329-73-1 |
| Literature: Richmond, Ann; Yang, Jinming; Amiri, Katayoun; Dhawan, Punita Patent: US2006/25419 A1, 2006 ; Location in patent: Page/Page column 5 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |