3-Fluoro-4-nitrotoluene structure
|
Common Name | 3-Fluoro-4-nitrotoluene | ||
|---|---|---|---|---|
| CAS Number | 446-34-4 | Molecular Weight | 155.126 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 258.6±0.0 °C at 760 mmHg | |
| Molecular Formula | C7H6FNO2 | Melting Point | 52-55 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 104.1±21.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Fluoro-4-nitrotoluene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 258.6±0.0 °C at 760 mmHg |
| Melting Point | 52-55 °C(lit.) |
| Molecular Formula | C7H6FNO2 |
| Molecular Weight | 155.126 |
| Flash Point | 104.1±21.8 °C |
| Exact Mass | 155.038254 |
| PSA | 45.82000 |
| LogP | 2.15 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.530 |
| InChIKey | WZMOWQCNPFDWPA-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(F)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37-S45-S37-S28A |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2904909090 |
|
~%
3-Fluoro-4-nitr... CAS#:446-34-4 |
| Literature: Zeng, Lei; Li, Jiaming; Muller, Michaela; Yan, Sherry; Mujtaba, Shiraz; Pan, Chongfeng; Wang, Zhiyong; Zhou, Ming-Ming Journal of the American Chemical Society, 2005 , vol. 127, # 8 p. 2376 - 2377 |
|
~%
3-Fluoro-4-nitr... CAS#:446-34-4 |
| Literature: Smith, Keith; Musson, Adam; DeBoos, Gareth A. Journal of Organic Chemistry, 1998 , vol. 63, # 23 p. 8448 - 8454 |
|
~%
3-Fluoro-4-nitr... CAS#:446-34-4 |
| Literature: Tomcufcik,A.S.; Seeger,D.R. Journal of Organic Chemistry, 1961 , vol. 26, p. 3351 - 3356 |
|
~%
3-Fluoro-4-nitr... CAS#:446-34-4 |
| Literature: Ostaszynski Bl. Soc. Sci. Lett. LodzChem.Abstr., 1952 , vol. 3, # 15 p. 4 Bl. Soc. Sci. Lett. LodzChem.Abstr., 1955 , p. 203 |
|
~%
3-Fluoro-4-nitr... CAS#:446-34-4 |
| Literature: Schiemann Chemische Berichte, 1929 , vol. 62, p. 1804 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
3-Hydroxyanthranilic acid inhibits PDK1 activation and suppresses experimental asthma by inducing T cell apoptosis.
Proc. Natl. Acad. Sci. U. S. A. 104 , 18619-24, (2007) 3-Hydroxyanthranilic acid (HAA), a compound generated during tryptophan metabolism initiated by indoleamine 2,3-dioxygenase, is known to induce T cell death, but its molecular target is not known. Her... |
| 2-fluoro-4-methyl-1-nitro-benzen |
| 3-Fluoro-4-nitrotoluene |
| 3-Fluoro-4-nitrotluene |
| 3-fluoro-4-Nitrotoluol |
| 4-methyl-2-fluoro-nitrobenzene |
| 3-fluoro-4-nitrobenzene |
| EINECS 207-166-5 |
| 2-Fluoro-4-methyl-1-nitrobenzene |
| 1-Nitro-2-fluoro-4-methylbenzene |
| MFCD00007053 |
| 2-Fluoro-4-methylnitrobenzene |
| 2-fluoro-4-(methyl)-1-nitrobenzene |
| 2-fluoro-1-nitro-4-methylbenzene |
| WNR BF D1 |
| 2-fluoro-4-methyl-nitrobenzene |