ethyl 2-(2-phenyl-1,3-thiazol-4-yl)acetate structure
|
Common Name | ethyl 2-(2-phenyl-1,3-thiazol-4-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 16441-34-2 | Molecular Weight | 247.31300 | |
| Density | 1.196g/cm3 | Boiling Point | 377.1ºC at 760mmHg | |
| Molecular Formula | C13H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.9ºC | |
| Name | ethyl 2-(2-phenyl-1,3-thiazol-4-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 377.1ºC at 760mmHg |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.31300 |
| Flash Point | 181.9ºC |
| Exact Mass | 247.06700 |
| PSA | 67.43000 |
| LogP | 2.91570 |
| Vapour Pressure | 6.89E-06mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | JXKUWLHMTFDRRS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1csc(-c2ccccc2)n1 |
| HS Code | 2934100090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| ethyl 2-phenylthiazole-4-acetate |