Di-Tert-Butyl Hydrazo dicarboxylate structure
|
Common Name | Di-Tert-Butyl Hydrazo dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 16466-61-8 | Molecular Weight | 232.277 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 294.6±9.0 °C at 760 mmHg | |
| Molecular Formula | C10H20N2O4 | Melting Point | 123-126ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 132.0±18.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | DI-Tert-Butyl Hydrazodicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 294.6±9.0 °C at 760 mmHg |
| Melting Point | 123-126ºC (dec.)(lit.) |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.277 |
| Flash Point | 132.0±18.7 °C |
| Exact Mass | 232.142303 |
| PSA | 76.66000 |
| LogP | 2.07 |
| Appearance of Characters | Powder or Crystalline Powder | White |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | TYSZETYVESRFNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC(=O)OC(C)(C)C |
| Water Solubility | Insoluble in water. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
A Convenient Synthesis of Pyrazolidine and 3-Amino-6, 7-dihydro-1H, 5H-pyrazolo [1, 2-a] pyrazol-1-one. Boros EE, et al.
J. Heterocycl. Chem. 38(3) , 613-616, (2001)
|
|
|
Catalytic amination of 2-substituted pyridines with hydrazine derivatives.
Org. Lett. 3(9) , 1351-4, (2001) [reaction in text] Protected pyridylhydrazine derivatives were prepared in a one-step palladium-catalyzed amination reaction using chelating phosphine ligands. 2-Pyridyl chlorides, bromides, and trifl... |
|
|
Synthesis of 17-alpha-substituted estradiol-pyridin-2-yl hydrazine conjugates as effective ligands for labeling with Alberto's complex fac-[Re(OH2)3(CO)3]+ in water.
J. Org. Chem. 68(18) , 7063-70, (2003) The development of (99m)Tc-estradiol radiopharmaceuticals would be advantageous for the detection of estrogen receptor-positive breast tumors. Estradiol derivatives conjugated to organometallic tricar... |
| tert-butyl N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| EINECS 240-512-3 |
| MFCD00015000 |
| Di-tert-butyl hydrazodiformate |
| Bis(2-methyl-2-propanyl) 1,2-hydrazinedicarboxylate |
| Di-tert-butyl Hydrazodicarboxylate |
| Di-tert-butyl 1,2-Hydrazinedicarboxylate |
| Di-tert-butyl hydrazine-1,2-dicarboxylate |
| Di-Tert-Butyl Hydrazo dicarboxylate |