[4-(dimethylamino)phenyl] diethyl phosphate structure
|
Common Name | [4-(dimethylamino)phenyl] diethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 16497-99-7 | Molecular Weight | 273.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(dimethylamino)phenyl] diethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H20NO4P |
|---|---|
| Molecular Weight | 273.26500 |
| Exact Mass | 273.11300 |
| PSA | 57.81000 |
| LogP | 3.31250 |
| InChIKey | LWMCQCZLCNDUJR-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)Oc1ccc(N(C)C)cc1 |
|
~%
[4-(dimethylami... CAS#:16497-99-7 |
| Literature: Andrews et al. Journal of the Chemical Society, 1952 , p. 780,782 |
| p-Dimethylaminophenyl-diethylphosphat |
| phosphoric acid diethyl ester-(4-dimethylamino-phenyl ester) |
| Diaethyl-(4-dimethylamino-phenyl)-phosphat |
| Phosphorsaeure-diaethylester-(4-dimethylamino-phenylester) |
| Phosphoric acid,4-(dimethylamino)phenyl diethyl ester |