[4-(dimethylamino)phenyl]-(3-nitrophenyl)methanone structure
|
Common Name | [4-(dimethylamino)phenyl]-(3-nitrophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 83699-49-4 | Molecular Weight | 270.28300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(dimethylamino)phenyl]-(3-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2O3 |
|---|---|
| Molecular Weight | 270.28300 |
| Exact Mass | 270.10000 |
| PSA | 66.13000 |
| LogP | 3.41500 |
| InChIKey | MBDAGVZWADRCEJ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)c2cccc([N+](=O)[O-])c2)cc1 |
|
~%
[4-(dimethylami... CAS#:83699-49-4 |
| Literature: Shah; Deshpande; Chaubal Journal of the Chemical Society, 1932 , p. 642,645 |
|
~%
[4-(dimethylami... CAS#:83699-49-4 |
| Literature: Shah; Deshpande; Chaubal Journal of the Chemical Society, 1932 , p. 642,645 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4'-Dimethylamino-3-nitro-benzophenon |
| 4'-dimethylamino-3-nitro-benzophenone |