(E)-2-(3-METHOXY-1-PROPEN-1-YL)-4 4 5 5& structure
|
Common Name | (E)-2-(3-METHOXY-1-PROPEN-1-YL)-4 4 5 5& | ||
|---|---|---|---|---|
| CAS Number | 165059-42-7 | Molecular Weight | 198.06700 | |
| Density | 0.933 g/mL at 25ºC(lit.) | Boiling Point | 229-230ºC(lit.) | |
| Molecular Formula | C10H19BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214 °F | |
| Name | 2-[(E)-3-methoxyprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.933 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 229-230ºC(lit.) |
| Molecular Formula | C10H19BO3 |
| Molecular Weight | 198.06700 |
| Flash Point | 214 °F |
| Exact Mass | 198.14300 |
| PSA | 27.69000 |
| LogP | 1.82040 |
| Vapour Pressure | 0.279mmHg at 25°C |
| Index of Refraction | n20/D 1.4430(lit.) |
| InChIKey | FBAOFKFCKHJXRU-VOTSOKGWSA-N |
| SMILES | COCC=CB1OC(C)(C)C(C)(C)O1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2931900090 |
|
~78%
(E)-2-(3-METHOX... CAS#:165059-42-7 |
| Literature: Shirakawa, Kazuya; Arase, Akira; Hoshi, Masayuki Synthesis, 2004 , # 11 p. 1814 - 1820 |
|
~%
(E)-2-(3-METHOX... CAS#:165059-42-7 |
| Literature: Synthesis, , # 11 p. 1814 - 1820 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD05664297 |
| trans-3-Methoxy-1-propenylboronic acid pinacol ester |
| B-5810 |