1,1,3-trichloro-1,2,2,3,3-pentafluoropropane structure
|
Common Name | 1,1,3-trichloro-1,2,2,3,3-pentafluoropropane | ||
|---|---|---|---|---|
| CAS Number | 1652-81-9 | Molecular Weight | 237.38300 | |
| Density | 1.7g/cm3 | Boiling Point | 73.8ºC at 760mmHg | |
| Molecular Formula | C3Cl3F5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 4ºC | |
| Name | 1,1,3-trichloro-1,2,2,3,3-pentafluoropropane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 73.8ºC at 760mmHg |
| Molecular Formula | C3Cl3F5 |
| Molecular Weight | 237.38300 |
| Flash Point | 4ºC |
| Exact Mass | 235.89900 |
| LogP | 3.55420 |
| Vapour Pressure | 123mmHg at 25°C |
| Index of Refraction | 1.365 |
| InChIKey | PSVOCRUYXNEMNE-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(F)C(F)(Cl)Cl |
| HS Code | 2903791090 |
|---|
| HS Code | 2903791090 |
|---|---|
| Summary | 2903791090 halogenated derivatives of methane, ethane or propane (hcfcs)only with fluorine and chlorine。supervision conditions:14xy(import license,export license,export license,export license)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 1,1,3-trichloro-1,2,2,3,3-pentafluoro-propane |
| 1,1,3-trichloropentafluoropropane |
| 1,1,3-Trichlor-1,2,2,3,3-pentafluor-propan |
| EINECS 216-718-4 |
| CCl2FCF2CClF2 |
| 1,1,3-Trichlor-pentafluor-propan |