1,3-Benzenediol,5-methyl-2-nitro- structure
|
Common Name | 1,3-Benzenediol,5-methyl-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 16533-36-1 | Molecular Weight | 169.13500 | |
| Density | 1.478g/cm3 | Boiling Point | 281.2ºC at 760mmHg | |
| Molecular Formula | C7H7NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.3ºC | |
| Name | 5-methyl-2-nitrobenzene-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.478g/cm3 |
|---|---|
| Boiling Point | 281.2ºC at 760mmHg |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.13500 |
| Flash Point | 126.3ºC |
| Exact Mass | 169.03800 |
| PSA | 86.28000 |
| LogP | 1.83760 |
| Vapour Pressure | 0.00212mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | VJUITVCKIWYTQX-UHFFFAOYSA-N |
| SMILES | Cc1cc(O)c([N+](=O)[O-])c(O)c1 |
| HS Code | 2908999090 |
|---|
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3,5-Dihydroxy-4-nitrotoluene |
| 1,3-Benzenediol,5-methyl-2-nitro |
| 4-Nitro-3.5-dioxy-1-methyl |
| 5-methyl-2-nitro-resorcinol |