6-(Trifluoromethyl)quinazolin-4(1H)-one structure
|
Common Name | 6-(Trifluoromethyl)quinazolin-4(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 16544-67-5 | Molecular Weight | 214.144 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 358.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H5F3N2O | Melting Point | 209-211°C | |
| MSDS | N/A | Flash Point | 170.3±27.9 °C | |
| Name | 6-(trifluoromethyl)-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 358.0±42.0 °C at 760 mmHg |
| Melting Point | 209-211°C |
| Molecular Formula | C9H5F3N2O |
| Molecular Weight | 214.144 |
| Flash Point | 170.3±27.9 °C |
| Exact Mass | 214.035400 |
| PSA | 46.01000 |
| LogP | 1.34 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | PTVVXBQQOLLVJP-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cnc2ccc(C(F)(F)F)cc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(Trifluoromethyl)quinazolin-4(3H)-one |
| 6-Trifluormethyl-3.4-dihydro-4-oxo-chinazolin |
| 4(3H)-Quinazolinone, 6-(trifluoromethyl)- |
| 6-(Trifluoromethyl)quinazolin-4(1H)-one |
| 6-(TRIFLUOROMETHYL)QUINAZOLIN-4-OL |
| 6-trifluoromethyl-3H-quinazolin-4-one |
| 6-(Trifluoromethyl)-4(1H)-quinazolinone |