Fmoc-NH-PEG1-C2-acid structure
|
Common Name | Fmoc-NH-PEG1-C2-acid | ||
|---|---|---|---|---|
| CAS Number | 1654740-73-4 | Molecular Weight | 355.384 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 589.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C20H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.6±27.3 °C | |
Use of Fmoc-NH-PEG1-C2-acidFmoc-NH-PEG1-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 3-(2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}ethoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-NH-PEG1-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 589.9±40.0 °C at 760 mmHg |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.384 |
| Flash Point | 310.6±27.3 °C |
| Exact Mass | 355.141968 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | LHBCOPWWQKLECJ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| MFCD16294357 |
| Propanoic acid, 3-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]- |
| 3-(2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}ethoxy)propanoic acid |
| Fmoc-6-Amino-4-oxahexanoic acid |