L-Cysteine,N,S-bis(2,4-dinitrophenyl)- structure
|
Common Name | L-Cysteine,N,S-bis(2,4-dinitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 1655-62-5 | Molecular Weight | 453.34000 | |
| Density | 1.73g/cm3 | Boiling Point | 729.1ºC at 760mmHg | |
| Molecular Formula | C15H11N5O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 394.7ºC | |
| Name | N,S-Di(DNP)-L-cysteine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Boiling Point | 729.1ºC at 760mmHg |
| Molecular Formula | C15H11N5O10S |
| Molecular Weight | 453.34000 |
| Flash Point | 394.7ºC |
| Exact Mass | 453.02300 |
| PSA | 257.91000 |
| LogP | 5.14260 |
| Vapour Pressure | 2.59E-22mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | BWXMKHIUCXHRIC-UHFFFAOYSA-N |
| SMILES | O=C(O)C(CSc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| WGK Germany | 3 |
|---|---|
| HS Code | 2930909090 |
|
~%
L-Cysteine,N,S-... CAS#:1655-62-5 |
| Literature: Sokolovsky,M. et al. Journal of the American Chemical Society, 1964 , vol. 86, p. 1212 - 1217 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,S-bis-(2,4-dinitro-phenyl)-L-cysteine |