L-Cysteine, S-[bis(4-methoxyphenyl)phenylmethyl]- structure
|
Common Name | L-Cysteine, S-[bis(4-methoxyphenyl)phenylmethyl]- | ||
|---|---|---|---|---|
| CAS Number | 61137-70-0 | Molecular Weight | 423.52500 | |
| Density | 1.234g/cm3 | Boiling Point | 588.8ºC at 760 mmHg | |
| Molecular Formula | C24H25NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.9ºC | |
| Name | L-Cysteine, S-[bis(4-methoxyphenyl)phenylmethyl] |
|---|
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 588.8ºC at 760 mmHg |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.52500 |
| Flash Point | 309.9ºC |
| Exact Mass | 423.15000 |
| PSA | 107.08000 |
| LogP | 4.84110 |
| Index of Refraction | 1.616 |
| InChIKey | MMPGFLZZIDSTQQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(SCC(N)C(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
|
~%
L-Cysteine, S-[... CAS#:61137-70-0 |
| Literature: Zee-Cheng,K.-Y.; Cheng,C.C. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 414 - 418 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |