4,4'-OXYBIS(METHOXYBENZENE) structure
|
Common Name | 4,4'-OXYBIS(METHOXYBENZENE) | ||
|---|---|---|---|---|
| CAS Number | 1655-74-9 | Molecular Weight | 230.25900 | |
| Density | 1.106g/cm3 | Boiling Point | 335.9ºC at 760mmHg | |
| Molecular Formula | C14H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.8ºC | |
| Name | 1-methoxy-4-(4-methoxyphenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 335.9ºC at 760mmHg |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.25900 |
| Flash Point | 112.8ºC |
| Exact Mass | 230.09400 |
| PSA | 27.69000 |
| LogP | 3.49610 |
| Vapour Pressure | 0.000226mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | CBDLNOVOFXJEOB-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2ccc(OC)cc2)cc1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,4'-dimethoxy-diphenylether |
| bis(4-methoxyphenyl) ether |
| 4,4'-oxybis(methoxybenzene) |
| 4,4'-oxybis(1-methoxybenzene) |
| Ether,bis(p-methoxyphenyl) |
| Benzene,1,1'-oxybis[4-methoxy |